C12H15BrF4N2OS — CID 106481129
5-bromo-6-(2-methylpropyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione (PubChem CID 106481129) has the molecular formula C12H15BrF4N2OS and a molecular weight of 391.23 g/mol. Its IUPAC name is 5-bromo-6-(2-methylpropyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-(2-methylpropyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481129 |
| Molecular Formula | C12H15BrF4N2OS |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 5-bromo-6-(2-methylpropyl)-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1[nH]c(COCC(F)(F)C(F)F)nc(=S)c1Br |
| InChI | InChI=1S/C12H15BrF4N2OS/c1-6(2)3-7-9(13)10(21)19-8(18-7)4-20-5-12(16,17)11(14)15/h6,11H,3-5H2,1-2H3,(H,18,19,21) |
| InChIKey | QHUJTZXMNILWCG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|