C8H10ClN3S — CID 106482667
2-(chloromethyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione (PubChem CID 106482667) has the molecular formula C8H10ClN3S and a molecular weight of 215.71 g/mol. Its IUPAC name is 2-(chloromethyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione.
| Compound Name | 2-(chloromethyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482667 |
| Molecular Formula | C8H10ClN3S |
| Molecular Weight | 215.71 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2-(chloromethyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
| SMILES | S=c1nc(CCl)[nH]c2c1CNCC2 |
| InChI | InChI=1S/C8H10ClN3S/c9-3-7-11-6-1-2-10-4-5(6)8(13)12-7/h10H,1-4H2,(H,11,12,13) |
| InChIKey | VSRMBMDELWOWEM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.71 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|