C10H10N4S2 — CID 106482874
2-(1,3-thiazol-4-yl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione (PubChem CID 106482874) has the molecular formula C10H10N4S2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-(1,3-thiazol-4-yl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione.
| Compound Name | 2-(1,3-thiazol-4-yl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482874 |
| Molecular Formula | C10H10N4S2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-(1,3-thiazol-4-yl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
| SMILES | S=c1nc(-c2cscn2)[nH]c2c1CNCC2 |
| InChI | InChI=1S/C10H10N4S2/c15-10-6-3-11-2-1-7(6)13-9(14-10)8-4-16-5-12-8/h4-5,11H,1-3H2,(H,13,14,15) |
| InChIKey | ZSIWOGBRMRICPU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|