C12H13N3OS — CID 106482691
2-(2-methylfuran-3-yl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione (PubChem CID 106482691) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-(2-methylfuran-3-yl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione.
| Compound Name | 2-(2-methylfuran-3-yl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482691 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-(2-methylfuran-3-yl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
| SMILES | Cc1occc1-c1nc(=S)c2c([nH]1)CCNC2 |
| InChI | InChI=1S/C12H13N3OS/c1-7-8(3-5-16-7)11-14-10-2-4-13-6-9(10)12(17)15-11/h3,5,13H,2,4,6H2,1H3,(H,14,15,17) |
| InChIKey | YFLAUJKGCHCCTJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|