C13H12N4O2S — CID 106482856
2-(2-nitrophenyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione (PubChem CID 106482856) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione.
| Compound Name | 2-(2-nitrophenyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482856 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-(2-nitrophenyl)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine-4-thione |
| SMILES | O=[N+]([O-])c1ccccc1-c1nc(=S)c2c([nH]1)CCNC2 |
| InChI | InChI=1S/C13H12N4O2S/c18-17(19)11-4-2-1-3-8(11)12-15-10-5-6-14-7-9(10)13(20)16-12/h1-4,14H,5-7H2,(H,15,16,20) |
| InChIKey | GJOQASVFCSHXGV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|