C15H20N2O2 — CID 106484934
[4-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]phenyl]methanamine (PubChem CID 106484934) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [4-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]phenyl]methanamine.
| Compound Name | [4-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 106484934 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [4-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]phenyl]methanamine |
| SMILES | CC(C)(C)c1cnc(COc2ccc(CN)cc2)o1 |
| InChI | InChI=1S/C15H20N2O2/c1-15(2,3)13-9-17-14(19-13)10-18-12-6-4-11(8-16)5-7-12/h4-7,9H,8,10,16H2,1-3H3 |
| InChIKey | PPPDIWVWRGIPRR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |