C19H20N2O3S2 — CID 68894916
(5E)-5-[[4-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]phenyl]methylidene]-2-methylsulfanyl-1,3-thiazol-4-one (PubChem CID 68894916) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (5E)-5-[[4-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]phenyl]methylidene]-2-methylsulfanyl-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[4-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]phenyl]methylidene]-2-methylsulfanyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 68894916 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (5E)-5-[[4-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]phenyl]methylidene]-2-methylsulfanyl-1,3-thiazol-4-one |
| SMILES | CSC1=NC(=O)/C(=C\c2ccc(OCc3ncc(C(C)(C)C)o3)cc2)S1 |
| InChI | InChI=1S/C19H20N2O3S2/c1-19(2,3)15-10-20-16(24-15)11-23-13-7-5-12(6-8-13)9-14-17(22)21-18(25-4)26-14/h5-10H,11H2,1-4H3/b14-9+ |
| InChIKey | VAYKWVGWZNQQJW-NTEUORMPSA-N |
| XLogP | 4.88 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|