C17H22O6S6 — CID 10649498
2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylic acid (PubChem CID 10649498) has the molecular formula C17H22O6S6 and a molecular weight of 514.76 g/mol. Its IUPAC name is 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylic acid.
| Compound Name | 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylic acid |
|---|---|
| PubChem CID | 10649498 |
| Molecular Formula | C17H22O6S6 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 513.97 |
| IUPAC Name | 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylic acid |
| SMILES | O=C(O)C1=CSC(=C2SC3=C(SCCOCCOCCOCCOCCS3)S2)S1 |
| InChI | InChI=1S/C17H22O6S6/c18-13(19)12-11-26-16(27-12)17-28-14-15(29-17)25-10-8-23-6-4-21-2-1-20-3-5-22-7-9-24-14/h11H,1-10H2,(H,18,19) |
| InChIKey | NJKMBWSESFWFLD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |