C18H22O8S6 — CID 11800960
2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4,5-dicarboxylic acid (PubChem CID 11800960) has the molecular formula C18H22O8S6 and a molecular weight of 558.77 g/mol. Its IUPAC name is 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4,5-dicarboxylic acid.
| Compound Name | 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 11800960 |
| Molecular Formula | C18H22O8S6 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 557.96 |
| IUPAC Name | 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4,5-dicarboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)O)SC(=C2SC3=C(SCCOCCOCCOCCOCCS3)S2)S1 |
| InChI | InChI=1S/C18H22O8S6/c19-13(20)11-12(14(21)22)30-17(29-11)18-31-15-16(32-18)28-10-8-26-6-4-24-2-1-23-3-5-25-7-9-27-15/h1-10H2,(H,19,20)(H,21,22) |
| InChIKey | GSEPWPCCYTTWID-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |