C20H26O8S6 — CID 11801493
dimethyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11801493) has the molecular formula C20H26O8S6 and a molecular weight of 586.82 g/mol. Its IUPAC name is dimethyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11801493 |
| Molecular Formula | C20H26O8S6 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | dimethyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(SCCOCCOCCOCCOCCS3)S2)S1 |
| InChI | InChI=1S/C20H26O8S6/c1-23-15(21)13-14(16(22)24-2)32-19(31-13)20-33-17-18(34-20)30-12-10-28-8-6-26-4-3-25-5-7-27-9-11-29-17/h3-12H2,1-2H3 |
| InChIKey | ZFKJBCFDBJESTC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |