C18H24O6S6 — CID 10673736
methyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylate (PubChem CID 10673736) has the molecular formula C18H24O6S6 and a molecular weight of 528.79 g/mol. Its IUPAC name is methyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylate.
| Compound Name | methyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 10673736 |
| Molecular Formula | C18H24O6S6 |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 527.99 |
| IUPAC Name | methyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylate |
| SMILES | COC(=O)C1=CSC(=C2SC3=C(SCCOCCOCCOCCOCCS3)S2)S1 |
| InChI | InChI=1S/C18H24O6S6/c1-20-14(19)13-12-27-17(28-13)18-29-15-16(30-18)26-11-9-24-7-5-22-3-2-21-4-6-23-8-10-25-15/h12H,2-11H2,1H3 |
| InChIKey | CNUVQRSQKJQQBF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |