C22H30O9S6 — CID 11802142
dimethyl 2-(5,8,11,14,17-pentaoxa-2,20,22,24-tetrathiabicyclo[19.3.0]tetracos-1(21)-en-23-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 11802142) has the molecular formula C22H30O9S6 and a molecular weight of 630.88 g/mol. Its IUPAC name is dimethyl 2-(5,8,11,14,17-pentaoxa-2,20,22,24-tetrathiabicyclo[19.3.0]tetracos-1(21)-en-23-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(5,8,11,14,17-pentaoxa-2,20,22,24-tetrathiabicyclo[19.3.0]tetracos-1(21)-en-23-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11802142 |
| Molecular Formula | C22H30O9S6 |
| Molecular Weight | 630.88 g/mol |
| Exact Mass | 630.02 |
| IUPAC Name | dimethyl 2-(5,8,11,14,17-pentaoxa-2,20,22,24-tetrathiabicyclo[19.3.0]tetracos-1(21)-en-23-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(SCCOCCOCCOCCOCCOCCS3)S2)S1 |
| InChI | InChI=1S/C22H30O9S6/c1-25-17(23)15-16(18(24)26-2)35-21(34-15)22-36-19-20(37-22)33-14-12-31-10-8-29-6-4-27-3-5-28-7-9-30-11-13-32-19/h3-14H2,1-2H3 |
| InChIKey | RKUHPTIOMIWJJE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.88 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |