C18H22O7S6 — CID 10578425
dimethyl 2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 10578425) has the molecular formula C18H22O7S6 and a molecular weight of 542.77 g/mol. Its IUPAC name is dimethyl 2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10578425 |
| Molecular Formula | C18H22O7S6 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | dimethyl 2-(5,8,11-trioxa-2,14,16,18-tetrathiabicyclo[13.3.0]octadec-1(15)-en-17-ylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2SC3=C(SCCOCCOCCOCCS3)S2)S1 |
| InChI | InChI=1S/C18H22O7S6/c1-21-13(19)11-12(14(20)22-2)29-17(28-11)18-30-15-16(31-18)27-10-8-25-6-4-23-3-5-24-7-9-26-15/h3-10H2,1-2H3 |
| InChIKey | OSBZMUWGKZFRBG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |