C15H26O5S — CID 106499952
ethyl 4-hydroxy-4-(oxan-4-ylsulfinylmethyl)cyclohexane-1-carboxylate (PubChem CID 106499952) has the molecular formula C15H26O5S and a molecular weight of 318.44 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-(oxan-4-ylsulfinylmethyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-hydroxy-4-(oxan-4-ylsulfinylmethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106499952 |
| Molecular Formula | C15H26O5S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | ethyl 4-hydroxy-4-(oxan-4-ylsulfinylmethyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(CS(=O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C15H26O5S/c1-2-20-14(16)12-3-7-15(17,8-4-12)11-21(18)13-5-9-19-10-6-13/h12-13,17H,2-11H2,1H3 |
| InChIKey | KQSJKWWFTOAEPD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |