C34H31N2O3P — CID 10650237
benzyl (2R)-2-[[diphenylphosphoryl(pyridin-3-yl)methyl]amino]-3-phenylpropanoate (PubChem CID 10650237) has the molecular formula C34H31N2O3P and a molecular weight of 546.61 g/mol. Its IUPAC name is benzyl (2R)-2-[[diphenylphosphoryl(pyridin-3-yl)methyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2R)-2-[[diphenylphosphoryl(pyridin-3-yl)methyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10650237 |
| Molecular Formula | C34H31N2O3P |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | benzyl (2R)-2-[[diphenylphosphoryl(pyridin-3-yl)methyl]amino]-3-phenylpropanoate |
| SMILES | O=C(OCc1ccccc1)[C@@H](Cc1ccccc1)NC(c1cccnc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H31N2O3P/c37-34(39-26-28-16-7-2-8-17-28)32(24-27-14-5-1-6-15-27)36-33(29-18-13-23-35-25-29)40(38,30-19-9-3-10-20-30)31-21-11-4-12-22-31/h1-23,25,32-33,36H,24,26H2/t32-,33?/m1/s1 |
| InChIKey | AQKUIGFEZAOEDM-KWRHIPAJSA-N |
| XLogP | 6.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|