C25H27N2O4P — CID 16741928
methyl (2S)-2-[[(2E)-1-diphenylphosphoryl-2-hydroxyiminopropyl]amino]-3-phenylpropanoate (PubChem CID 16741928) has the molecular formula C25H27N2O4P and a molecular weight of 450.48 g/mol. Its IUPAC name is methyl (2S)-2-[[(2E)-1-diphenylphosphoryl-2-hydroxyiminopropyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(2E)-1-diphenylphosphoryl-2-hydroxyiminopropyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 16741928 |
| Molecular Formula | C25H27N2O4P |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | methyl (2S)-2-[[(2E)-1-diphenylphosphoryl-2-hydroxyiminopropyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(/C(C)=N/O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N2O4P/c1-19(27-29)24(26-23(25(28)31-2)18-20-12-6-3-7-13-20)32(30,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,23-24,26,29H,18H2,1-2H3/b27-19+/t23-,24?/m0/s1 |
| InChIKey | ZUWQXZJHIQHKPV-PFQGYUBPSA-N |
| XLogP | 3.55 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|