C16H26BrNO3S — CID 106507452
tert-butyl N-[2-[(5-bromothiophen-2-yl)methyl]-2-(hydroxymethyl)pentyl]carbamate (PubChem CID 106507452) has the molecular formula C16H26BrNO3S and a molecular weight of 392.36 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-bromothiophen-2-yl)methyl]-2-(hydroxymethyl)pentyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-bromothiophen-2-yl)methyl]-2-(hydroxymethyl)pentyl]carbamate |
|---|---|
| PubChem CID | 106507452 |
| Molecular Formula | C16H26BrNO3S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | tert-butyl N-[2-[(5-bromothiophen-2-yl)methyl]-2-(hydroxymethyl)pentyl]carbamate |
| SMILES | CCCC(CO)(CNC(=O)OC(C)(C)C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C16H26BrNO3S/c1-5-8-16(11-19,9-12-6-7-13(17)22-12)10-18-14(20)21-15(2,3)4/h6-7,19H,5,8-11H2,1-4H3,(H,18,20) |
| InChIKey | BPKCZPOVBWTLPQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |