C36H38N4O5 — CID 10651325
ethyl 3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]benzoate (PubChem CID 10651325) has the molecular formula C36H38N4O5 and a molecular weight of 606.72 g/mol. Its IUPAC name is ethyl 3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]benzoate.
| Compound Name | ethyl 3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 10651325 |
| Molecular Formula | C36H38N4O5 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | ethyl 3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)NC2C(=O)N(CC34CC5CC(CC(C5)C3)C4)c3ccccc3N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C36H38N4O5/c1-2-45-34(43)26-9-8-10-27(18-26)37-35(44)38-31-32(41)39(22-36-19-23-15-24(20-36)17-25(16-23)21-36)29-13-6-7-14-30(29)40(33(31)42)28-11-4-3-5-12-28/h3-14,18,23-25,31H,2,15-17,19-22H2,1H3,(H2,37,38,44) |
| InChIKey | UVVBLIXCOWILDE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|