C40H43NO3S — CID 10651485
4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methylsulfanyl]benzoyl]indol-3-yl]butanoic acid (PubChem CID 10651485) has the molecular formula C40H43NO3S and a molecular weight of 617.86 g/mol. Its IUPAC name is 4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methylsulfanyl]benzoyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methylsulfanyl]benzoyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 10651485 |
| Molecular Formula | C40H43NO3S |
| Molecular Weight | 617.86 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | 4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methylsulfanyl]benzoyl]indol-3-yl]butanoic acid |
| SMILES | CC(C)Cc1ccc(C(Sc2cccc(C(=O)n3cc(CCCC(=O)O)c4ccccc43)c2)c2ccc(CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C40H43NO3S/c1-27(2)23-29-15-19-31(20-16-29)39(32-21-17-30(18-22-32)24-28(3)4)45-35-11-7-9-33(25-35)40(44)41-26-34(10-8-14-38(42)43)36-12-5-6-13-37(36)41/h5-7,9,11-13,15-22,25-28,39H,8,10,14,23-24H2,1-4H3,(H,42,43) |
| InChIKey | BLYWLALFVQUYTF-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.86 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |