C8H8N4S — CID 106515886
6-(1-methylpyrazol-4-yl)-1H-pyrimidine-4-thione (PubChem CID 106515886) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 6-(1-methylpyrazol-4-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(1-methylpyrazol-4-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106515886 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 6-(1-methylpyrazol-4-yl)-1H-pyrimidine-4-thione |
| SMILES | Cn1cc(-c2cc(=S)nc[nH]2)cn1 |
| InChI | InChI=1S/C8H8N4S/c1-12-4-6(3-11-12)7-2-8(13)10-5-9-7/h2-5H,1H3,(H,9,10,13) |
| InChIKey | IRJUTDRPXCZYDC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|