C9H10N4S — CID 106515951
6-(1-ethylpyrazol-4-yl)-1H-pyrimidine-4-thione (PubChem CID 106515951) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 6-(1-ethylpyrazol-4-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-(1-ethylpyrazol-4-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106515951 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 6-(1-ethylpyrazol-4-yl)-1H-pyrimidine-4-thione |
| SMILES | CCn1cc(-c2cc(=S)nc[nH]2)cn1 |
| InChI | InChI=1S/C9H10N4S/c1-2-13-5-7(4-12-13)8-3-9(14)11-6-10-8/h3-6H,2H2,1H3,(H,10,11,14) |
| InChIKey | VXQZXTHCNWUNJT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|