C30H46O11S2 — CID 10651797
2-[2-[2-[2-[2-(1-methylsulfonyloxyhexan-2-yloxy)phenoxy]ethoxy]ethoxy]phenoxy]hexyl methanesulfonate (PubChem CID 10651797) has the molecular formula C30H46O11S2 and a molecular weight of 646.82 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(1-methylsulfonyloxyhexan-2-yloxy)phenoxy]ethoxy]ethoxy]phenoxy]hexyl methanesulfonate.
| Compound Name | 2-[2-[2-[2-[2-(1-methylsulfonyloxyhexan-2-yloxy)phenoxy]ethoxy]ethoxy]phenoxy]hexyl methanesulfonate |
|---|---|
| PubChem CID | 10651797 |
| Molecular Formula | C30H46O11S2 |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | 2-[2-[2-[2-[2-(1-methylsulfonyloxyhexan-2-yloxy)phenoxy]ethoxy]ethoxy]phenoxy]hexyl methanesulfonate |
| SMILES | CCCCC(COS(C)(=O)=O)Oc1ccccc1OCCOCCOc1ccccc1OC(CCCC)COS(C)(=O)=O |
| InChI | InChI=1S/C30H46O11S2/c1-5-7-13-25(23-38-42(3,31)32)40-29-17-11-9-15-27(29)36-21-19-35-20-22-37-28-16-10-12-18-30(28)41-26(14-8-6-2)24-39-43(4,33)34/h9-12,15-18,25-26H,5-8,13-14,19-24H2,1-4H3 |
| InChIKey | JORDUAVWNHUOIW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|