C36H42ClN3O6 — CID 10651815
3,3-diphenylpropyl-[2-[5-methoxycarbonyl-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]oxy-2-methylpropyl]-methylazanium chloride (PubChem CID 10651815) has the molecular formula C36H42ClN3O6 and a molecular weight of 648.20 g/mol. Its IUPAC name is 3,3-diphenylpropyl-[2-[5-methoxycarbonyl-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]oxy-2-methylpropyl]-methylazanium chloride.
| Compound Name | 3,3-diphenylpropyl-[2-[5-methoxycarbonyl-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]oxy-2-methylpropyl]-methylazanium chloride |
|---|---|
| PubChem CID | 10651815 |
| Molecular Formula | C36H42ClN3O6 |
| Molecular Weight | 648.20 g/mol |
| Exact Mass | 647.28 |
| IUPAC Name | 3,3-diphenylpropyl-[2-[5-methoxycarbonyl-2,6-dimethyl-4-(4-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]oxy-2-methylpropyl]-methylazanium chloride |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)(C)C[NH+](C)CCC(c2ccccc2)c2ccccc2)C1c1ccc([N+](=O)[O-])cc1.[Cl-] |
| InChI | InChI=1S/C36H41N3O6.ClH/c1-24-31(34(40)44-6)33(28-17-19-29(20-18-28)39(42)43)32(25(2)37-24)35(41)45-36(3,4)23-38(5)22-21-30(26-13-9-7-10-14-26)27-15-11-8-12-16-27;/h7-20,30,33,37H,21-23H2,1-6H3;1H |
| InChIKey | SQQDSAGOXFOGON-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|