C42H54ClN3O7 — CID 10652623
[2-[2,6-dimethyl-5-(2-methyl-1-propoxypropan-2-yl)oxycarbonyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]oxy-2-methylpropyl]-(3,3-diphenylpropyl)-methylazanium chloride (PubChem CID 10652623) has the molecular formula C42H54ClN3O7 and a molecular weight of 748.36 g/mol. Its IUPAC name is [2-[2,6-dimethyl-5-(2-methyl-1-propoxypropan-2-yl)oxycarbonyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]oxy-2-methylpropyl]-(3,3-diphenylpropyl)-methylazanium chloride.
| Compound Name | [2-[2,6-dimethyl-5-(2-methyl-1-propoxypropan-2-yl)oxycarbonyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]oxy-2-methylpropyl]-(3,3-diphenylpropyl)-methylazanium chloride |
|---|---|
| PubChem CID | 10652623 |
| Molecular Formula | C42H54ClN3O7 |
| Molecular Weight | 748.36 g/mol |
| Exact Mass | 747.37 |
| IUPAC Name | [2-[2,6-dimethyl-5-(2-methyl-1-propoxypropan-2-yl)oxycarbonyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carbonyl]oxy-2-methylpropyl]-(3,3-diphenylpropyl)-methylazanium chloride |
| SMILES | CCCOCC(C)(C)OC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)(C)C[NH+](C)CCC(c2ccccc2)c2ccccc2)C1c1cccc([N+](=O)[O-])c1.[Cl-] |
| InChI | InChI=1S/C42H53N3O7.ClH/c1-9-25-50-28-42(6,7)52-40(47)37-30(3)43-29(2)36(38(37)33-21-16-22-34(26-33)45(48)49)39(46)51-41(4,5)27-44(8)24-23-35(31-17-12-10-13-18-31)32-19-14-11-15-20-32;/h10-22,26,35,38,43H,9,23-25,27-28H2,1-8H3;1H |
| InChIKey | OXSSNBRCDJPIMV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|