C38H46ClN3O7 — CID 10604667
2-[2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-1,4-dihydropyridine-3-carbonyl]oxyethyl-(3,3-diphenylpropyl)-methylazanium chloride (PubChem CID 10604667) has the molecular formula C38H46ClN3O7 and a molecular weight of 692.25 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-1,4-dihydropyridine-3-carbonyl]oxyethyl-(3,3-diphenylpropyl)-methylazanium chloride.
| Compound Name | 2-[2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-1,4-dihydropyridine-3-carbonyl]oxyethyl-(3,3-diphenylpropyl)-methylazanium chloride |
|---|---|
| PubChem CID | 10604667 |
| Molecular Formula | C38H46ClN3O7 |
| Molecular Weight | 692.25 g/mol |
| Exact Mass | 691.30 |
| IUPAC Name | 2-[2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-1,4-dihydropyridine-3-carbonyl]oxyethyl-(3,3-diphenylpropyl)-methylazanium chloride |
| SMILES | CCCOCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC[NH+](C)CCC(c2ccccc2)c2ccccc2)C1c1cccc([N+](=O)[O-])c1.[Cl-] |
| InChI | InChI=1S/C38H45N3O7.ClH/c1-5-22-46-24-25-48-38(43)35-28(3)39-27(2)34(36(35)31-17-12-18-32(26-31)41(44)45)37(42)47-23-21-40(4)20-19-33(29-13-8-6-9-14-29)30-15-10-7-11-16-30;/h6-18,26,33,36,39H,5,19-25H2,1-4H3;1H |
| InChIKey | XKNDJVHOUJCSBG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|