C38H48N8O7 — CID 10652514
benzyl N-[3-[5-[[(2S)-4-amino-4-oxo-2-[[2-(4-phenylmethoxyphenyl)acetyl]amino]butanoyl]amino]pentylamino]-3-oxopropyl]-N-(3-azidopropyl)carbamate (PubChem CID 10652514) has the molecular formula C38H48N8O7 and a molecular weight of 728.85 g/mol. Its IUPAC name is benzyl N-[3-[5-[[(2S)-4-amino-4-oxo-2-[[2-(4-phenylmethoxyphenyl)acetyl]amino]butanoyl]amino]pentylamino]-3-oxopropyl]-N-(3-azidopropyl)carbamate.
| Compound Name | benzyl N-[3-[5-[[(2S)-4-amino-4-oxo-2-[[2-(4-phenylmethoxyphenyl)acetyl]amino]butanoyl]amino]pentylamino]-3-oxopropyl]-N-(3-azidopropyl)carbamate |
|---|---|
| PubChem CID | 10652514 |
| Molecular Formula | C38H48N8O7 |
| Molecular Weight | 728.85 g/mol |
| Exact Mass | 728.36 |
| IUPAC Name | benzyl N-[3-[5-[[(2S)-4-amino-4-oxo-2-[[2-(4-phenylmethoxyphenyl)acetyl]amino]butanoyl]amino]pentylamino]-3-oxopropyl]-N-(3-azidopropyl)carbamate |
| SMILES | [N-]=[N+]=NCCCN(CCC(=O)NCCCCCNC(=O)[C@H](CC(N)=O)NC(=O)Cc1ccc(OCc2ccccc2)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H48N8O7/c39-34(47)26-33(44-36(49)25-29-15-17-32(18-16-29)52-27-30-11-4-1-5-12-30)37(50)42-21-9-3-8-20-41-35(48)19-24-46(23-10-22-43-45-40)38(51)53-28-31-13-6-2-7-14-31/h1-2,4-7,11-18,33H,3,8-10,19-28H2,(H2,39,47)(H,41,48)(H,42,50)(H,44,49)/t33-/m0/s1 |
| InChIKey | NUBXLUWFZYFQQD-XIFFEERXSA-N |
| XLogP | 4.30 |
| TPSA | 217.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|