C38H58O6S2Sn — CID 10652890
[(8E)-6,6-bis(benzenesulfonyl)-3,9-dimethyl-10-tributylstannyldeca-1,8-dien-3-yl] acetate (PubChem CID 10652890) has the molecular formula C38H58O6S2Sn and a molecular weight of 793.72 g/mol. Its IUPAC name is [(8E)-6,6-bis(benzenesulfonyl)-3,9-dimethyl-10-tributylstannyldeca-1,8-dien-3-yl] acetate.
| Compound Name | [(8E)-6,6-bis(benzenesulfonyl)-3,9-dimethyl-10-tributylstannyldeca-1,8-dien-3-yl] acetate |
|---|---|
| PubChem CID | 10652890 |
| Molecular Formula | C38H58O6S2Sn |
| Molecular Weight | 793.72 g/mol |
| Exact Mass | 794.27 |
| IUPAC Name | [(8E)-6,6-bis(benzenesulfonyl)-3,9-dimethyl-10-tributylstannyldeca-1,8-dien-3-yl] acetate |
| SMILES | C=CC(C)(CCC(C/C=C(\C)C[Sn](CCCC)(CCCC)CCCC)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C26H31O6S2.3C4H9.Sn/c1-6-25(5,32-22(4)27)19-20-26(18-17-21(2)3,33(28,29)23-13-9-7-10-14-23)34(30,31)24-15-11-8-12-16-24;3*1-3-4-2;/h6-17H,1-2,18-20H2,3-5H3;3*1,3-4H2,2H3;/b21-17-;;;; |
| InChIKey | BJKMYIWLSQGDEJ-NEHFJTNRSA-N |
| XLogP | 10.10 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.72 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|