C30H34O4S2Si — CID 10929691
[(E)-5,5-bis(benzenesulfonyl)-2-methyl-8-phenyloct-2-en-7-ynyl]-trimethylsilane (PubChem CID 10929691) has the molecular formula C30H34O4S2Si and a molecular weight of 550.82 g/mol. Its IUPAC name is [(E)-5,5-bis(benzenesulfonyl)-2-methyl-8-phenyloct-2-en-7-ynyl]-trimethylsilane.
| Compound Name | [(E)-5,5-bis(benzenesulfonyl)-2-methyl-8-phenyloct-2-en-7-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10929691 |
| Molecular Formula | C30H34O4S2Si |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | [(E)-5,5-bis(benzenesulfonyl)-2-methyl-8-phenyloct-2-en-7-ynyl]-trimethylsilane |
| SMILES | C/C(=C\CC(CC#Cc1ccccc1)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C30H34O4S2Si/c1-26(25-37(2,3)4)22-24-30(23-14-17-27-15-8-5-9-16-27,35(31,32)28-18-10-6-11-19-28)36(33,34)29-20-12-7-13-21-29/h5-13,15-16,18-22H,23-25H2,1-4H3/b26-22+ |
| InChIKey | YMKRFYWDXHOBCL-XTCLZLMSSA-N |
| XLogP | 6.75 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|