C28H32O8S2 — CID 14976890
4-[(E)-8,8-bis(benzenesulfonyl)-4-methylundec-4-en-10-ynoxy]-4-oxobutanoic acid (PubChem CID 14976890) has the molecular formula C28H32O8S2 and a molecular weight of 560.69 g/mol. Its IUPAC name is 4-[(E)-8,8-bis(benzenesulfonyl)-4-methylundec-4-en-10-ynoxy]-4-oxobutanoic acid.
| Compound Name | 4-[(E)-8,8-bis(benzenesulfonyl)-4-methylundec-4-en-10-ynoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14976890 |
| Molecular Formula | C28H32O8S2 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 4-[(E)-8,8-bis(benzenesulfonyl)-4-methylundec-4-en-10-ynoxy]-4-oxobutanoic acid |
| SMILES | C#CCC(CC/C=C(\C)CCCOC(=O)CCC(=O)O)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H32O8S2/c1-3-20-28(37(32,33)24-14-6-4-7-15-24,38(34,35)25-16-8-5-9-17-25)21-10-12-23(2)13-11-22-36-27(31)19-18-26(29)30/h1,4-9,12,14-17H,10-11,13,18-22H2,2H3,(H,29,30)/b23-12+ |
| InChIKey | KSZJFFYCOVUPTF-FSJBWODESA-N |
| XLogP | 4.57 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|