C16H20N4 — CID 106552005
2-(1-cyclopropyl-4-methylimidazol-2-yl)-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 106552005) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(1-cyclopropyl-4-methylimidazol-2-yl)-3,4-dihydro-1H-isoquinolin-5-amine.
| Compound Name | 2-(1-cyclopropyl-4-methylimidazol-2-yl)-3,4-dihydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 106552005 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-(1-cyclopropyl-4-methylimidazol-2-yl)-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | Cc1cn(C2CC2)c(N2CCc3c(N)cccc3C2)n1 |
| InChI | InChI=1S/C16H20N4/c1-11-9-20(13-5-6-13)16(18-11)19-8-7-14-12(10-19)3-2-4-15(14)17/h2-4,9,13H,5-8,10,17H2,1H3 |
| InChIKey | UFXNBYHOMWWPIQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|