C15H17N3 — CID 114932785
2-(4,6-dimethyl-2-pyridinyl)-1,3-dihydroisoindol-4-amine (PubChem CID 114932785) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-pyridinyl)-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-(4,6-dimethyl-2-pyridinyl)-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 114932785 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-(4,6-dimethyl-2-pyridinyl)-1,3-dihydroisoindol-4-amine |
| SMILES | Cc1cc(C)nc(N2Cc3cccc(N)c3C2)c1 |
| InChI | InChI=1S/C15H17N3/c1-10-6-11(2)17-15(7-10)18-8-12-4-3-5-14(16)13(12)9-18/h3-7H,8-9,16H2,1-2H3 |
| InChIKey | NKZMZUMEDYOEST-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|