C14H10F4N2 — CID 107645773
2-(2,3,5,6-tetrafluorophenyl)-1,3-dihydroisoindol-4-amine (PubChem CID 107645773) has the molecular formula C14H10F4N2 and a molecular weight of 282.24 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrafluorophenyl)-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-(2,3,5,6-tetrafluorophenyl)-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 107645773 |
| Molecular Formula | C14H10F4N2 |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(2,3,5,6-tetrafluorophenyl)-1,3-dihydroisoindol-4-amine |
| SMILES | Nc1cccc2c1CN(c1c(F)c(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C14H10F4N2/c15-9-4-10(16)13(18)14(12(9)17)20-5-7-2-1-3-11(19)8(7)6-20/h1-4H,5-6,19H2 |
| InChIKey | WHRXQCPFICSTTF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|