C10H18N4 — CID 106553972
N'-ethyl-N'-(1-prop-2-enylimidazol-2-yl)ethane-1,2-diamine (PubChem CID 106553972) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-ethyl-N'-(1-prop-2-enylimidazol-2-yl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-(1-prop-2-enylimidazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 106553972 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-ethyl-N'-(1-prop-2-enylimidazol-2-yl)ethane-1,2-diamine |
| SMILES | C=CCn1ccnc1N(CC)CCN |
| InChI | InChI=1S/C10H18N4/c1-3-7-14-9-6-12-10(14)13(4-2)8-5-11/h3,6,9H,1,4-5,7-8,11H2,2H3 |
| InChIKey | MPPXXIZIDNNCTO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|