About 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide
7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 10656936) has the molecular formula C7H8N4O3S
and a molecular weight of 228.23 g/mol. Its IUPAC name is 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide.
Molecular Properties
| Compound Name | 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide |
| PubChem CID | 10656936 |
| Molecular Formula | C7H8N4O3S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | CNc1ccc(S(N)(=O)=O)c2nonc12 |
| InChI | InChI=1S/C7H8N4O3S/c1-9-4-2-3-5(15(8,12)13)7-6(4)10-14-11-7/h2-3,9H,1H3,(H2,8,12,13) |
| InChIKey | YKZAIIOWFCIBJQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide?
The IUPAC name of 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide (CID 10656936) is 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide.
What is the SMILES notation for 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide?
The canonical SMILES for 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide is CNc1ccc(S(N)(=O)=O)c2nonc12.
What is the InChIKey of 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide?
The InChIKey is YKZAIIOWFCIBJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O3S/c1-9-4-2-3-5(15(8,12)13)7-6(4)10-14-11-7/h2-3,9H,1H3,(H2,8,12,13).
What are the key properties of 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide?
7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide has a molecular weight of 228.23 g/mol, XLogP of -0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide is sourced from PubChem (CID 10656936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).