C7H8N4O3S — CID 10656936
7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 10656936) has the molecular formula C7H8N4O3S and a molecular weight of 228.23 g/mol. Its IUPAC name is 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 10656936 |
| Molecular Formula | C7H8N4O3S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 7-(methylamino)-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | CNc1ccc(S(N)(=O)=O)c2nonc12 |
| InChI | InChI=1S/C7H8N4O3S/c1-9-4-2-3-5(15(8,12)13)7-6(4)10-14-11-7/h2-3,9H,1H3,(H2,8,12,13) |
| InChIKey | YKZAIIOWFCIBJQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |