C12H13N3O2 — CID 10657144
11,13-dimethyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),2,7-triene-10,12-dione (PubChem CID 10657144) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 11,13-dimethyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),2,7-triene-10,12-dione.
| Compound Name | 11,13-dimethyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),2,7-triene-10,12-dione |
|---|---|
| PubChem CID | 10657144 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 11,13-dimethyl-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),2,7-triene-10,12-dione |
| SMILES | Cn1c(=O)c2cc3c(nc2n(C)c1=O)CCC3 |
| InChI | InChI=1S/C12H13N3O2/c1-14-10-8(11(16)15(2)12(14)17)6-7-4-3-5-9(7)13-10/h6H,3-5H2,1-2H3 |
| InChIKey | AUMSYZXHZLGJMR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |