C17H23N3O2 — CID 15882302
13,15-dimethyl-13,15,17-triazatricyclo[8.7.1.011,16]octadeca-1(17),10(18),11(16)-triene-12,14-dione (PubChem CID 15882302) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 13,15-dimethyl-13,15,17-triazatricyclo[8.7.1.011,16]octadeca-1(17),10(18),11(16)-triene-12,14-dione.
| Compound Name | 13,15-dimethyl-13,15,17-triazatricyclo[8.7.1.011,16]octadeca-1(17),10(18),11(16)-triene-12,14-dione |
|---|---|
| PubChem CID | 15882302 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 13,15-dimethyl-13,15,17-triazatricyclo[8.7.1.011,16]octadeca-1(17),10(18),11(16)-triene-12,14-dione |
| SMILES | Cn1c(=O)c2c3cc(nc2n(C)c1=O)CCCCCCCC3 |
| InChI | InChI=1S/C17H23N3O2/c1-19-15-14(16(21)20(2)17(19)22)12-9-7-5-3-4-6-8-10-13(11-12)18-15/h11H,3-10H2,1-2H3 |
| InChIKey | DBVCYJMBPQCVNX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |