C13H12N4O3 — CID 13142789
5,7,12-trimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,4,6-trione (PubChem CID 13142789) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5,7,12-trimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,4,6-trione.
| Compound Name | 5,7,12-trimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,4,6-trione |
|---|---|
| PubChem CID | 13142789 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 5,7,12-trimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-2,4,6-trione |
| SMILES | Cc1ccn2c(=O)c3c(=O)n(C)c(=O)n(C)c3nc2c1 |
| InChI | InChI=1S/C13H12N4O3/c1-7-4-5-17-8(6-7)14-10-9(12(17)19)11(18)16(3)13(20)15(10)2/h4-6H,1-3H3 |
| InChIKey | HDWAQIQZIPSJJS-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 78.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|