C14H13N5O3 — CID 13142805
12-acetyl-2-imino-5,7-dimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-4,6-dione (PubChem CID 13142805) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 12-acetyl-2-imino-5,7-dimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-4,6-dione.
| Compound Name | 12-acetyl-2-imino-5,7-dimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-4,6-dione |
|---|---|
| PubChem CID | 13142805 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 12-acetyl-2-imino-5,7-dimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-4,6-dione |
| SMILES | [H]/N=c1/c2c(=O)n(C)c(=O)n(C)c2nc2cc(C(C)=O)ccn12 |
| InChI | InChI=1S/C14H13N5O3/c1-7(20)8-4-5-19-9(6-8)16-12-10(11(19)15)13(21)18(3)14(22)17(12)2/h4-6,15H,1-3H3/b15-11- |
| InChIKey | ZAKWBTOCFMPJEB-PTNGSMBKSA-N |
| XLogP | -0.43 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|