C10H8ClN5O2 — CID 121215825
8-chloro-1,3-dimethylpurino[7,8-a]pyrimidine-2,4-dione (PubChem CID 121215825) has the molecular formula C10H8ClN5O2 and a molecular weight of 265.66 g/mol. Its IUPAC name is 8-chloro-1,3-dimethylpurino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 8-chloro-1,3-dimethylpurino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121215825 |
| Molecular Formula | C10H8ClN5O2 |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 8-chloro-1,3-dimethylpurino[7,8-a]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(nc3nc(Cl)ccn32)n(C)c1=O |
| InChI | InChI=1S/C10H8ClN5O2/c1-14-7-6(8(17)15(2)10(14)18)16-4-3-5(11)12-9(16)13-7/h3-4H,1-2H3 |
| InChIKey | DMDHJZRJIINPGE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |