C14H14N4O4 — CID 134090427
(1,3-dimethyl-2,4-dioxopurino[7,8-a]pyridin-8-yl)methyl acetate (PubChem CID 134090427) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is (1,3-dimethyl-2,4-dioxopurino[7,8-a]pyridin-8-yl)methyl acetate.
| Compound Name | (1,3-dimethyl-2,4-dioxopurino[7,8-a]pyridin-8-yl)methyl acetate |
|---|---|
| PubChem CID | 134090427 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (1,3-dimethyl-2,4-dioxopurino[7,8-a]pyridin-8-yl)methyl acetate |
| SMILES | CC(=O)OCc1ccn2c(c1)nc1c2c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C14H14N4O4/c1-8(19)22-7-9-4-5-18-10(6-9)15-12-11(18)13(20)17(3)14(21)16(12)2/h4-6H,7H2,1-3H3 |
| InChIKey | QKKFOGLMNBVETD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |