C15H15N5O4 — CID 13142807
ethyl 2-imino-5,7-dimethyl-4,6-dioxo-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-12-carboxylate (PubChem CID 13142807) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is ethyl 2-imino-5,7-dimethyl-4,6-dioxo-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-12-carboxylate.
| Compound Name | ethyl 2-imino-5,7-dimethyl-4,6-dioxo-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 13142807 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | ethyl 2-imino-5,7-dimethyl-4,6-dioxo-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-12-carboxylate |
| SMILES | [H]/N=c1/c2c(=O)n(C)c(=O)n(C)c2nc2cc(C(=O)OCC)ccn12 |
| InChI | InChI=1S/C15H15N5O4/c1-4-24-14(22)8-5-6-20-9(7-8)17-12-10(11(20)16)13(21)19(3)15(23)18(12)2/h5-7,16H,4H2,1-3H3/b16-11- |
| InChIKey | XLVQOFDOGBANOA-WJDWOHSUSA-N |
| XLogP | -0.46 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|