C14H15N5O2 — CID 46872676
5-amino-2,4,7,9-tetramethylpyrimido[4,5-h][1,6]naphthyridine-8,10-dione (PubChem CID 46872676) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 5-amino-2,4,7,9-tetramethylpyrimido[4,5-h][1,6]naphthyridine-8,10-dione.
| Compound Name | 5-amino-2,4,7,9-tetramethylpyrimido[4,5-h][1,6]naphthyridine-8,10-dione |
|---|---|
| PubChem CID | 46872676 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-amino-2,4,7,9-tetramethylpyrimido[4,5-h][1,6]naphthyridine-8,10-dione |
| SMILES | Cc1cc(C)c2c(N)nc3c(c(=O)n(C)c(=O)n3C)c2n1 |
| InChI | InChI=1S/C14H15N5O2/c1-6-5-7(2)16-10-8(6)11(15)17-12-9(10)13(20)19(4)14(21)18(12)3/h5H,1-4H3,(H2,15,17) |
| InChIKey | GJEKTFUZILHKIN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|