C13H7F4N3O2 — CID 57207604
5,6,7,8-tetrafluoro-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 57207604) has the molecular formula C13H7F4N3O2 and a molecular weight of 313.21 g/mol. Its IUPAC name is 5,6,7,8-tetrafluoro-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 5,6,7,8-tetrafluoro-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 57207604 |
| Molecular Formula | C13H7F4N3O2 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 5,6,7,8-tetrafluoro-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | Cn1c(=O)c2c(F)c3c(F)c(F)c(F)cc3nc2n(C)c1=O |
| InChI | InChI=1S/C13H7F4N3O2/c1-19-11-7(12(21)20(2)13(19)22)9(16)6-5(18-11)3-4(14)8(15)10(6)17/h3H,1-2H3 |
| InChIKey | KKNMZZOTLXDNDK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|