C17H12F7N3O3 — CID 71817307
5-(1,1,2,2,3,3,3-heptafluoropropyl)-8-methoxy-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 71817307) has the molecular formula C17H12F7N3O3 and a molecular weight of 439.29 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-8-methoxy-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-8-methoxy-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 71817307 |
| Molecular Formula | C17H12F7N3O3 |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-8-methoxy-1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | COc1ccc2c(C(F)(F)C(F)(F)C(F)(F)F)c3c(=O)n(C)c(=O)n(C)c3nc2c1 |
| InChI | InChI=1S/C17H12F7N3O3/c1-26-12-10(13(28)27(2)14(26)29)11(15(18,19)16(20,21)17(22,23)24)8-5-4-7(30-3)6-9(8)25-12/h4-6H,1-3H3 |
| InChIKey | YVYLHDGDZCESBU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|