C14H24O3 — CID 10657695
(2S,3S,4S,6R)-2-ethyl-6-(furan-2-yl)-4-methylheptane-1,3-diol (PubChem CID 10657695) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (2S,3S,4S,6R)-2-ethyl-6-(furan-2-yl)-4-methylheptane-1,3-diol.
| Compound Name | (2S,3S,4S,6R)-2-ethyl-6-(furan-2-yl)-4-methylheptane-1,3-diol |
|---|---|
| PubChem CID | 10657695 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2S,3S,4S,6R)-2-ethyl-6-(furan-2-yl)-4-methylheptane-1,3-diol |
| SMILES | CC[C@@H](CO)[C@@H](O)[C@@H](C)C[C@@H](C)c1ccco1 |
| InChI | InChI=1S/C14H24O3/c1-4-12(9-15)14(16)11(3)8-10(2)13-6-5-7-17-13/h5-7,10-12,14-16H,4,8-9H2,1-3H3/t10-,11+,12+,14+/m1/s1 |
| InChIKey | SHWPKTUMQDQLRD-UHXUPSOCSA-N |
| XLogP | 2.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |