C16H14N2O2 — CID 10659387
4-(2-pyrrolo[2,3-b]pyridin-1-ylethoxy)benzaldehyde (PubChem CID 10659387) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-(2-pyrrolo[2,3-b]pyridin-1-ylethoxy)benzaldehyde.
| Compound Name | 4-(2-pyrrolo[2,3-b]pyridin-1-ylethoxy)benzaldehyde |
|---|---|
| PubChem CID | 10659387 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-(2-pyrrolo[2,3-b]pyridin-1-ylethoxy)benzaldehyde |
| SMILES | O=Cc1ccc(OCCn2ccc3cccnc32)cc1 |
| InChI | InChI=1S/C16H14N2O2/c19-12-13-3-5-15(6-4-13)20-11-10-18-9-7-14-2-1-8-17-16(14)18/h1-9,12H,10-11H2 |
| InChIKey | WWEFFIYYHOTTBZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|