C15H19N3O2 — CID 106593889
5-[4-[(4-hydroxycyclohexyl)amino]phenyl]-1,2-dihydropyrazol-3-one (PubChem CID 106593889) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-[4-[(4-hydroxycyclohexyl)amino]phenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-[4-[(4-hydroxycyclohexyl)amino]phenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 106593889 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-[4-[(4-hydroxycyclohexyl)amino]phenyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1cc(-c2ccc(NC3CCC(O)CC3)cc2)[nH][nH]1 |
| InChI | InChI=1S/C15H19N3O2/c19-13-7-5-12(6-8-13)16-11-3-1-10(2-4-11)14-9-15(20)18-17-14/h1-4,9,12-13,16,19H,5-8H2,(H2,17,18,20) |
| InChIKey | FVYJPFGTLHTABP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |