C12H16N6OS — CID 106597120
5,6-diethyl-3-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyridazine-4-carbothioamide (PubChem CID 106597120) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is 5,6-diethyl-3-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyridazine-4-carbothioamide.
| Compound Name | 5,6-diethyl-3-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 106597120 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5,6-diethyl-3-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyridazine-4-carbothioamide |
| SMILES | CCc1nnc(Oc2ncn(C)n2)c(C(N)=S)c1CC |
| InChI | InChI=1S/C12H16N6OS/c1-4-7-8(5-2)15-16-11(9(7)10(13)20)19-12-14-6-18(3)17-12/h6H,4-5H2,1-3H3,(H2,13,20) |
| InChIKey | IDNMFAYKAVPCQO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|