C18H23NO3 — CID 10662044
(3R,4S)-1-but-3-enyl-4-[(1R)-1-hydroxybut-3-enyl]-3-phenylmethoxyazetidin-2-one (PubChem CID 10662044) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3R,4S)-1-but-3-enyl-4-[(1R)-1-hydroxybut-3-enyl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3R,4S)-1-but-3-enyl-4-[(1R)-1-hydroxybut-3-enyl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 10662044 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (3R,4S)-1-but-3-enyl-4-[(1R)-1-hydroxybut-3-enyl]-3-phenylmethoxyazetidin-2-one |
| SMILES | C=CCCN1C(=O)[C@H](OCc2ccccc2)[C@@H]1[C@H](O)CC=C |
| InChI | InChI=1S/C18H23NO3/c1-3-5-12-19-16(15(20)9-4-2)17(18(19)21)22-13-14-10-7-6-8-11-14/h3-4,6-8,10-11,15-17,20H,1-2,5,9,12-13H2/t15-,16+,17-/m1/s1 |
| InChIKey | RNBLGIWZFXGJSX-IXDOHACOSA-N |
| XLogP | 2.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|