C17H26N2O3 — CID 10662447
tert-butyl 5-prop-2-enyl-5-(pyrrolidine-1-carbonyl)-2H-pyrrole-1-carboxylate (PubChem CID 10662447) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl 5-prop-2-enyl-5-(pyrrolidine-1-carbonyl)-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-prop-2-enyl-5-(pyrrolidine-1-carbonyl)-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 10662447 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl 5-prop-2-enyl-5-(pyrrolidine-1-carbonyl)-2H-pyrrole-1-carboxylate |
| SMILES | C=CCC1(C(=O)N2CCCC2)C=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-5-9-17(14(20)18-11-6-7-12-18)10-8-13-19(17)15(21)22-16(2,3)4/h5,8,10H,1,6-7,9,11-13H2,2-4H3 |
| InChIKey | BOZCERFUMGGOHO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|